C21H23ClN4O4S — CID 41346172
5-chloro-N-[2-(diethylamino)ethyl]-N-(5-methoxy-1,3-benzothiazol-2-yl)-2-nitrobenzamide (PubChem CID 41346172) has the molecular formula C21H23ClN4O4S and a molecular weight of 462.96 g/mol. Its IUPAC name is 5-chloro-N-[2-(diethylamino)ethyl]-N-(5-methoxy-1,3-benzothiazol-2-yl)-2-nitrobenzamide.
| Compound Name | 5-chloro-N-[2-(diethylamino)ethyl]-N-(5-methoxy-1,3-benzothiazol-2-yl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 41346172 |
| Molecular Formula | C21H23ClN4O4S |
| Molecular Weight | 462.96 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 5-chloro-N-[2-(diethylamino)ethyl]-N-(5-methoxy-1,3-benzothiazol-2-yl)-2-nitrobenzamide |
| SMILES | CCN(CC)CCN(C(=O)c1cc(Cl)ccc1[N+](=O)[O-])c1nc2cc(OC)ccc2s1 |
| InChI | InChI=1S/C21H23ClN4O4S/c1-4-24(5-2)10-11-25(20(27)16-12-14(22)6-8-18(16)26(28)29)21-23-17-13-15(30-3)7-9-19(17)31-21/h6-9,12-13H,4-5,10-11H2,1-3H3 |
| InChIKey | CLZKVIIPLRUHHY-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.96 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|