C23H27ClN4O5S — CID 43961625
N-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-4,5-dimethoxy-2-nitrobenzamide (PubChem CID 43961625) has the molecular formula C23H27ClN4O5S and a molecular weight of 507.01 g/mol. Its IUPAC name is N-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-4,5-dimethoxy-2-nitrobenzamide.
| Compound Name | N-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-4,5-dimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 43961625 |
| Molecular Formula | C23H27ClN4O5S |
| Molecular Weight | 507.01 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | N-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-4,5-dimethoxy-2-nitrobenzamide |
| SMILES | CCN(CC)CCN(C(=O)c1cc(OC)c(OC)cc1[N+](=O)[O-])c1nc2c(C)c(Cl)ccc2s1 |
| InChI | InChI=1S/C23H27ClN4O5S/c1-6-26(7-2)10-11-27(23-25-21-14(3)16(24)8-9-20(21)34-23)22(29)15-12-18(32-4)19(33-5)13-17(15)28(30)31/h8-9,12-13H,6-7,10-11H2,1-5H3 |
| InChIKey | MAYPUVGHAQOQQH-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 98.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.01 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|