C24H30N4O7S — CID 43961617
N-[2-(diethylamino)ethyl]-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-4,5-dimethoxy-2-nitrobenzamide (PubChem CID 43961617) has the molecular formula C24H30N4O7S and a molecular weight of 518.59 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-4,5-dimethoxy-2-nitrobenzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-4,5-dimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 43961617 |
| Molecular Formula | C24H30N4O7S |
| Molecular Weight | 518.59 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-4,5-dimethoxy-2-nitrobenzamide |
| SMILES | CCN(CC)CCN(C(=O)c1cc(OC)c(OC)cc1[N+](=O)[O-])c1nc2c(OC)ccc(OC)c2s1 |
| InChI | InChI=1S/C24H30N4O7S/c1-7-26(8-2)11-12-27(24-25-21-17(32-3)9-10-18(33-4)22(21)36-24)23(29)15-13-19(34-5)20(35-6)14-16(15)28(30)31/h9-10,13-14H,7-8,11-12H2,1-6H3 |
| InChIKey | CCFLVBZTYRIKMS-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 116.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.59 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|