C21H23ClN4O5S — CID 43961624
N-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-4,5-dimethoxy-2-nitrobenzamide (PubChem CID 43961624) has the molecular formula C21H23ClN4O5S and a molecular weight of 478.96 g/mol. Its IUPAC name is N-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-4,5-dimethoxy-2-nitrobenzamide.
| Compound Name | N-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-4,5-dimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 43961624 |
| Molecular Formula | C21H23ClN4O5S |
| Molecular Weight | 478.96 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | N-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-4,5-dimethoxy-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)N(CCN(C)C)c2nc3c(C)c(Cl)ccc3s2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C21H23ClN4O5S/c1-12-14(22)6-7-18-19(12)23-21(32-18)25(9-8-24(2)3)20(27)13-10-16(30-4)17(31-5)11-15(13)26(28)29/h6-7,10-11H,8-9H2,1-5H3 |
| InChIKey | ACMBYSSKLDYXSC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 98.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.96 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|