C20H22N4O5S — CID 43961594
N-(1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-4,5-dimethoxy-2-nitrobenzamide (PubChem CID 43961594) has the molecular formula C20H22N4O5S and a molecular weight of 430.49 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-4,5-dimethoxy-2-nitrobenzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-4,5-dimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 43961594 |
| Molecular Formula | C20H22N4O5S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-4,5-dimethoxy-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)N(CCN(C)C)c2nc3ccccc3s2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C20H22N4O5S/c1-22(2)9-10-23(20-21-14-7-5-6-8-18(14)30-20)19(25)13-11-16(28-3)17(29-4)12-15(13)24(26)27/h5-8,11-12H,9-10H2,1-4H3 |
| InChIKey | VDXGJNPXGVIEEF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 98.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|