C17H14N2O6S — CID 2705231
1,3-benzothiazol-2-ylmethyl 4,5-dimethoxy-2-nitrobenzoate (PubChem CID 2705231) has the molecular formula C17H14N2O6S and a molecular weight of 374.37 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 4,5-dimethoxy-2-nitrobenzoate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 4,5-dimethoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 2705231 |
| Molecular Formula | C17H14N2O6S |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 4,5-dimethoxy-2-nitrobenzoate |
| SMILES | COc1cc(C(=O)OCc2nc3ccccc3s2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C17H14N2O6S/c1-23-13-7-10(12(19(21)22)8-14(13)24-2)17(20)25-9-16-18-11-5-3-4-6-15(11)26-16/h3-8H,9H2,1-2H3 |
| InChIKey | SBIMUFBMPMORGH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 100.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|