C17H14N2O4S — CID 78822413
2-(1,3-benzothiazol-2-yl)ethyl 2-methyl-3-nitrobenzoate (PubChem CID 78822413) has the molecular formula C17H14N2O4S and a molecular weight of 342.38 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)ethyl 2-methyl-3-nitrobenzoate.
| Compound Name | 2-(1,3-benzothiazol-2-yl)ethyl 2-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 78822413 |
| Molecular Formula | C17H14N2O4S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)ethyl 2-methyl-3-nitrobenzoate |
| SMILES | Cc1c(C(=O)OCCc2nc3ccccc3s2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14N2O4S/c1-11-12(5-4-7-14(11)19(21)22)17(20)23-10-9-16-18-13-6-2-3-8-15(13)24-16/h2-8H,9-10H2,1H3 |
| InChIKey | ZYFFZZNENCRZQH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|