C18H14N2O6 — CID 2564560
2-(1,3-dioxoisoindol-2-yl)ethyl 2-methyl-3-nitrobenzoate (PubChem CID 2564560) has the molecular formula C18H14N2O6 and a molecular weight of 354.32 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 2-methyl-3-nitrobenzoate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 2564560 |
| Molecular Formula | C18H14N2O6 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2-methyl-3-nitrobenzoate |
| SMILES | Cc1c(C(=O)OCCN2C(=O)c3ccccc3C2=O)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H14N2O6/c1-11-12(7-4-8-15(11)20(24)25)18(23)26-10-9-19-16(21)13-5-2-3-6-14(13)17(19)22/h2-8H,9-10H2,1H3 |
| InChIKey | WNLUCNDMOXFYGK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|