C17H11ClN2O6 — CID 2631302
2-(1,3-dioxoisoindol-2-yl)ethyl 2-chloro-5-nitrobenzoate (PubChem CID 2631302) has the molecular formula C17H11ClN2O6 and a molecular weight of 374.74 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 2-chloro-5-nitrobenzoate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2-chloro-5-nitrobenzoate |
|---|---|
| PubChem CID | 2631302 |
| Molecular Formula | C17H11ClN2O6 |
| Molecular Weight | 374.74 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2-chloro-5-nitrobenzoate |
| SMILES | O=C(OCCN1C(=O)c2ccccc2C1=O)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C17H11ClN2O6/c18-14-6-5-10(20(24)25)9-13(14)17(23)26-8-7-19-15(21)11-3-1-2-4-12(11)16(19)22/h1-6,9H,7-8H2 |
| InChIKey | ZZAKUHUOYLUBAU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.74 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|