C17H14N4O6 — CID 75401363
3-(1,3-dioxoisoindol-2-yl)propyl 2-amino-5-nitropyridine-3-carboxylate (PubChem CID 75401363) has the molecular formula C17H14N4O6 and a molecular weight of 370.32 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)propyl 2-amino-5-nitropyridine-3-carboxylate.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)propyl 2-amino-5-nitropyridine-3-carboxylate |
|---|---|
| PubChem CID | 75401363 |
| Molecular Formula | C17H14N4O6 |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)propyl 2-amino-5-nitropyridine-3-carboxylate |
| SMILES | Nc1ncc([N+](=O)[O-])cc1C(=O)OCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H14N4O6/c18-14-13(8-10(9-19-14)21(25)26)17(24)27-7-3-6-20-15(22)11-4-1-2-5-12(11)16(20)23/h1-2,4-5,8-9H,3,6-7H2,(H2,18,19) |
| InChIKey | HJEIZTOZGHGKAV-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 145.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|