C18H16N2O4 — CID 18074643
4-(1,3-dioxoisoindol-2-yl)butyl pyridine-2-carboxylate (PubChem CID 18074643) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)butyl pyridine-2-carboxylate.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)butyl pyridine-2-carboxylate |
|---|---|
| PubChem CID | 18074643 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)butyl pyridine-2-carboxylate |
| SMILES | O=C(OCCCCN1C(=O)c2ccccc2C1=O)c1ccccn1 |
| InChI | InChI=1S/C18H16N2O4/c21-16-13-7-1-2-8-14(13)17(22)20(16)11-5-6-12-24-18(23)15-9-3-4-10-19-15/h1-4,7-10H,5-6,11-12H2 |
| InChIKey | REPUQUUKXVDSJM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|