C23H21N3O4 — CID 16575863
4-(1,3-dioxoisoindol-2-yl)butyl 1-benzylpyrazole-4-carboxylate (PubChem CID 16575863) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)butyl 1-benzylpyrazole-4-carboxylate.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)butyl 1-benzylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 16575863 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)butyl 1-benzylpyrazole-4-carboxylate |
| SMILES | O=C(OCCCCN1C(=O)c2ccccc2C1=O)c1cnn(Cc2ccccc2)c1 |
| InChI | InChI=1S/C23H21N3O4/c27-21-19-10-4-5-11-20(19)22(28)26(21)12-6-7-13-30-23(29)18-14-24-25(16-18)15-17-8-2-1-3-9-17/h1-5,8-11,14,16H,6-7,12-13,15H2 |
| InChIKey | YJJFHPUKUWUJIE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|