C17H18N2O3 — CID 42895011
(2-oxocyclohexyl) 1-benzylpyrazole-4-carboxylate (PubChem CID 42895011) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is (2-oxocyclohexyl) 1-benzylpyrazole-4-carboxylate.
| Compound Name | (2-oxocyclohexyl) 1-benzylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 42895011 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | (2-oxocyclohexyl) 1-benzylpyrazole-4-carboxylate |
| SMILES | O=C(OC1CCCCC1=O)c1cnn(Cc2ccccc2)c1 |
| InChI | InChI=1S/C17H18N2O3/c20-15-8-4-5-9-16(15)22-17(21)14-10-18-19(12-14)11-13-6-2-1-3-7-13/h1-3,6-7,10,12,16H,4-5,8-9,11H2 |
| InChIKey | XSMBQWUCRKWEJA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |