(2-oxocyclohexyl) 1-benzylpyrazole-4-carboxylate

C17H18N2O3 — CID 42895011

IUPAC(2-oxocyclohexyl) 1-benzylpyrazole-4-carboxylate
SMILESO=C(OC1CCCCC1=O)c1cnn(Cc2ccccc2)c1
InChIInChI=1S/C17H18N2O3/c20-15-8-4-5-9-16(15)22-17(21)14-10-18-19(12-14)11-13-6-2-1-3-7-13/h1-3,6-7,10,12,16H,4-5,8-9,11H2
InChIKeyXSMBQWUCRKWEJA-UHFFFAOYSA-N
MW298.34 g/mol
LogP2.60
Rot. Bonds4

About (2-oxocyclohexyl) 1-benzylpyrazole-4-carboxylate

(2-oxocyclohexyl) 1-benzylpyrazole-4-carboxylate (PubChem CID 42895011) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is (2-oxocyclohexyl) 1-benzylpyrazole-4-carboxylate.

Molecular Properties

Compound Name(2-oxocyclohexyl) 1-benzylpyrazole-4-carboxylate
PubChem CID42895011
Molecular FormulaC17H18N2O3
Molecular Weight298.34 g/mol
Exact Mass298.13
IUPAC Name(2-oxocyclohexyl) 1-benzylpyrazole-4-carboxylate
SMILESO=C(OC1CCCCC1=O)c1cnn(Cc2ccccc2)c1
InChIInChI=1S/C17H18N2O3/c20-15-8-4-5-9-16(15)22-17(21)14-10-18-19(12-14)11-13-6-2-1-3-7-13/h1-3,6-7,10,12,16H,4-5,8-9,11H2
InChIKeyXSMBQWUCRKWEJA-UHFFFAOYSA-N
XLogP2.60
TPSA61.19 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.34
LogP ≤ 52.60
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze (2-oxocyclohexyl) 1-benzylpyrazole-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-oxocyclohexyl) 1-benzylpyrazole-4-carboxylate?
The IUPAC name of (2-oxocyclohexyl) 1-benzylpyrazole-4-carboxylate (CID 42895011) is (2-oxocyclohexyl) 1-benzylpyrazole-4-carboxylate.
What is the SMILES notation for (2-oxocyclohexyl) 1-benzylpyrazole-4-carboxylate?
The canonical SMILES for (2-oxocyclohexyl) 1-benzylpyrazole-4-carboxylate is O=C(OC1CCCCC1=O)c1cnn(Cc2ccccc2)c1.
What is the InChIKey of (2-oxocyclohexyl) 1-benzylpyrazole-4-carboxylate?
The InChIKey is XSMBQWUCRKWEJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O3/c20-15-8-4-5-9-16(15)22-17(21)14-10-18-19(12-14)11-13-6-2-1-3-7-13/h1-3,6-7,10,12,16H,4-5,8-9,11H2.
What are the key properties of (2-oxocyclohexyl) 1-benzylpyrazole-4-carboxylate?
(2-oxocyclohexyl) 1-benzylpyrazole-4-carboxylate has a molecular weight of 298.34 g/mol, XLogP of 2.60, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxocyclohexyl) 1-benzylpyrazole-4-carboxylate is sourced from PubChem (CID 42895011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).