C16H15ClN2O4 — CID 42887303
(5-methyl-2-oxooxolan-3-yl) 1-[(2-chlorophenyl)methyl]pyrazole-4-carboxylate (PubChem CID 42887303) has the molecular formula C16H15ClN2O4 and a molecular weight of 334.76 g/mol. Its IUPAC name is (5-methyl-2-oxooxolan-3-yl) 1-[(2-chlorophenyl)methyl]pyrazole-4-carboxylate.
| Compound Name | (5-methyl-2-oxooxolan-3-yl) 1-[(2-chlorophenyl)methyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 42887303 |
| Molecular Formula | C16H15ClN2O4 |
| Molecular Weight | 334.76 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | (5-methyl-2-oxooxolan-3-yl) 1-[(2-chlorophenyl)methyl]pyrazole-4-carboxylate |
| SMILES | CC1CC(OC(=O)c2cnn(Cc3ccccc3Cl)c2)C(=O)O1 |
| InChI | InChI=1S/C16H15ClN2O4/c1-10-6-14(16(21)22-10)23-15(20)12-7-18-19(9-12)8-11-4-2-3-5-13(11)17/h2-5,7,9-10,14H,6,8H2,1H3 |
| InChIKey | LAQFEYRSGHBSFD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.76 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |