C15H15ClN4O2 — CID 25393908
1-[(2-chlorophenyl)methyl]-N'-(cyclopropanecarbonyl)pyrazole-4-carbohydrazide (PubChem CID 25393908) has the molecular formula C15H15ClN4O2 and a molecular weight of 318.76 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-N'-(cyclopropanecarbonyl)pyrazole-4-carbohydrazide.
| Compound Name | 1-[(2-chlorophenyl)methyl]-N'-(cyclopropanecarbonyl)pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 25393908 |
| Molecular Formula | C15H15ClN4O2 |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-N'-(cyclopropanecarbonyl)pyrazole-4-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CC1)c1cnn(Cc2ccccc2Cl)c1 |
| InChI | InChI=1S/C15H15ClN4O2/c16-13-4-2-1-3-11(13)8-20-9-12(7-17-20)15(22)19-18-14(21)10-5-6-10/h1-4,7,9-10H,5-6,8H2,(H,18,21)(H,19,22) |
| InChIKey | HALFWHXIEHVBRA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|