C18H22ClN3O2 — CID 18132255
1-[(2-chlorophenyl)methyl]-N-[3-(cyclopropylmethoxy)propyl]pyrazole-4-carboxamide (PubChem CID 18132255) has the molecular formula C18H22ClN3O2 and a molecular weight of 347.85 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-N-[3-(cyclopropylmethoxy)propyl]pyrazole-4-carboxamide.
| Compound Name | 1-[(2-chlorophenyl)methyl]-N-[3-(cyclopropylmethoxy)propyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 18132255 |
| Molecular Formula | C18H22ClN3O2 |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-N-[3-(cyclopropylmethoxy)propyl]pyrazole-4-carboxamide |
| SMILES | O=C(NCCCOCC1CC1)c1cnn(Cc2ccccc2Cl)c1 |
| InChI | InChI=1S/C18H22ClN3O2/c19-17-5-2-1-4-15(17)11-22-12-16(10-21-22)18(23)20-8-3-9-24-13-14-6-7-14/h1-2,4-5,10,12,14H,3,6-9,11,13H2,(H,20,23) |
| InChIKey | COVYWHFWHHEQJA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|