C18H25Cl2N5O — CID 119393831
1-[(2-chlorophenyl)methyl]-N-(3-piperazin-1-ylpropyl)pyrazole-4-carboxamide;hydrochloride (PubChem CID 119393831) has the molecular formula C18H25Cl2N5O and a molecular weight of 398.34 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-N-(3-piperazin-1-ylpropyl)pyrazole-4-carboxamide;hydrochloride.
| Compound Name | 1-[(2-chlorophenyl)methyl]-N-(3-piperazin-1-ylpropyl)pyrazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119393831 |
| Molecular Formula | C18H25Cl2N5O |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-N-(3-piperazin-1-ylpropyl)pyrazole-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCCN1CCNCC1)c1cnn(Cc2ccccc2Cl)c1 |
| InChI | InChI=1S/C18H24ClN5O.ClH/c19-17-5-2-1-4-15(17)13-24-14-16(12-22-24)18(25)21-6-3-9-23-10-7-20-8-11-23;/h1-2,4-5,12,14,20H,3,6-11,13H2,(H,21,25);1H |
| InChIKey | IPBIQRPETLVLTG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|