C20H35Cl2N5O — CID 119390903
4-[(4-methylpiperazin-1-yl)methyl]-N-(3-piperazin-1-ylpropyl)benzamide;dihydrochloride (PubChem CID 119390903) has the molecular formula C20H35Cl2N5O and a molecular weight of 432.44 g/mol. Its IUPAC name is 4-[(4-methylpiperazin-1-yl)methyl]-N-(3-piperazin-1-ylpropyl)benzamide;dihydrochloride.
| Compound Name | 4-[(4-methylpiperazin-1-yl)methyl]-N-(3-piperazin-1-ylpropyl)benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119390903 |
| Molecular Formula | C20H35Cl2N5O |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 4-[(4-methylpiperazin-1-yl)methyl]-N-(3-piperazin-1-ylpropyl)benzamide;dihydrochloride |
| SMILES | CN1CCN(Cc2ccc(C(=O)NCCCN3CCNCC3)cc2)CC1.Cl.Cl |
| InChI | InChI=1S/C20H33N5O.2ClH/c1-23-13-15-25(16-14-23)17-18-3-5-19(6-4-18)20(26)22-7-2-10-24-11-8-21-9-12-24;;/h3-6,21H,2,7-17H2,1H3,(H,22,26);2*1H |
| InChIKey | VQBQANAMZDYMBI-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|