C16H25N5O2 — CID 119391112
4-[(carbamoylamino)methyl]-N-(3-piperazin-1-ylpropyl)benzamide (PubChem CID 119391112) has the molecular formula C16H25N5O2 and a molecular weight of 319.41 g/mol. Its IUPAC name is 4-[(carbamoylamino)methyl]-N-(3-piperazin-1-ylpropyl)benzamide.
| Compound Name | 4-[(carbamoylamino)methyl]-N-(3-piperazin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 119391112 |
| Molecular Formula | C16H25N5O2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | 4-[(carbamoylamino)methyl]-N-(3-piperazin-1-ylpropyl)benzamide |
| SMILES | NC(=O)NCc1ccc(C(=O)NCCCN2CCNCC2)cc1 |
| InChI | InChI=1S/C16H25N5O2/c17-16(23)20-12-13-2-4-14(5-3-13)15(22)19-6-1-9-21-10-7-18-8-11-21/h2-5,18H,1,6-12H2,(H,19,22)(H3,17,20,23) |
| InChIKey | KRVMKPPKDGRTDJ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|