C14H19Cl2N3O — CID 43443287
2,3-dichloro-N-(3-piperazin-1-ylpropyl)benzamide (PubChem CID 43443287) has the molecular formula C14H19Cl2N3O and a molecular weight of 316.23 g/mol. Its IUPAC name is 2,3-dichloro-N-(3-piperazin-1-ylpropyl)benzamide.
| Compound Name | 2,3-dichloro-N-(3-piperazin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 43443287 |
| Molecular Formula | C14H19Cl2N3O |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 2,3-dichloro-N-(3-piperazin-1-ylpropyl)benzamide |
| SMILES | O=C(NCCCN1CCNCC1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H19Cl2N3O/c15-12-4-1-3-11(13(12)16)14(20)18-5-2-8-19-9-6-17-7-10-19/h1,3-4,17H,2,5-10H2,(H,18,20) |
| InChIKey | AEXAKVPIDOBADQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|