C17H27N3OS — CID 119393290
N-(3-piperazin-1-ylpropyl)-2-propan-2-ylsulfanylbenzamide (PubChem CID 119393290) has the molecular formula C17H27N3OS and a molecular weight of 321.49 g/mol. Its IUPAC name is N-(3-piperazin-1-ylpropyl)-2-propan-2-ylsulfanylbenzamide.
| Compound Name | N-(3-piperazin-1-ylpropyl)-2-propan-2-ylsulfanylbenzamide |
|---|---|
| PubChem CID | 119393290 |
| Molecular Formula | C17H27N3OS |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | N-(3-piperazin-1-ylpropyl)-2-propan-2-ylsulfanylbenzamide |
| SMILES | CC(C)Sc1ccccc1C(=O)NCCCN1CCNCC1 |
| InChI | InChI=1S/C17H27N3OS/c1-14(2)22-16-7-4-3-6-15(16)17(21)19-8-5-11-20-12-9-18-10-13-20/h3-4,6-7,14,18H,5,8-13H2,1-2H3,(H,19,21) |
| InChIKey | QYPNJCCMEVXOCB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|