C22H33ClN4O — CID 119392391
2,5-dimethyl-1-(1-phenylethyl)-N-(3-piperazin-1-ylpropyl)pyrrole-3-carboxamide;hydrochloride (PubChem CID 119392391) has the molecular formula C22H33ClN4O and a molecular weight of 404.99 g/mol. Its IUPAC name is 2,5-dimethyl-1-(1-phenylethyl)-N-(3-piperazin-1-ylpropyl)pyrrole-3-carboxamide;hydrochloride.
| Compound Name | 2,5-dimethyl-1-(1-phenylethyl)-N-(3-piperazin-1-ylpropyl)pyrrole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119392391 |
| Molecular Formula | C22H33ClN4O |
| Molecular Weight | 404.99 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 2,5-dimethyl-1-(1-phenylethyl)-N-(3-piperazin-1-ylpropyl)pyrrole-3-carboxamide;hydrochloride |
| SMILES | Cc1cc(C(=O)NCCCN2CCNCC2)c(C)n1C(C)c1ccccc1.Cl |
| InChI | InChI=1S/C22H32N4O.ClH/c1-17-16-21(19(3)26(17)18(2)20-8-5-4-6-9-20)22(27)24-10-7-13-25-14-11-23-12-15-25;/h4-6,8-9,16,18,23H,7,10-15H2,1-3H3,(H,24,27);1H |
| InChIKey | DCIYFHSBMFOOSY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 49.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.99 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|