C25H38N4O — CID 78871210
N-[4-(4-ethylpiperazin-1-yl)butyl]-2,5-dimethyl-1-(1-phenylethyl)pyrrole-3-carboxamide (PubChem CID 78871210) has the molecular formula C25H38N4O and a molecular weight of 410.61 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)butyl]-2,5-dimethyl-1-(1-phenylethyl)pyrrole-3-carboxamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)butyl]-2,5-dimethyl-1-(1-phenylethyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 78871210 |
| Molecular Formula | C25H38N4O |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 410.30 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)butyl]-2,5-dimethyl-1-(1-phenylethyl)pyrrole-3-carboxamide |
| SMILES | CCN1CCN(CCCCNC(=O)c2cc(C)n(C(C)c3ccccc3)c2C)CC1 |
| InChI | InChI=1S/C25H38N4O/c1-5-27-15-17-28(18-16-27)14-10-9-13-26-25(30)24-19-20(2)29(22(24)4)21(3)23-11-7-6-8-12-23/h6-8,11-12,19,21H,5,9-10,13-18H2,1-4H3,(H,26,30) |
| InChIKey | AHZZOZXCDLMWPK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|