C21H28N2O3 — CID 78852531
ethyl 4-[[2,5-dimethyl-1-(1-phenylethyl)pyrrole-3-carbonyl]amino]butanoate (PubChem CID 78852531) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is ethyl 4-[[2,5-dimethyl-1-(1-phenylethyl)pyrrole-3-carbonyl]amino]butanoate.
| Compound Name | ethyl 4-[[2,5-dimethyl-1-(1-phenylethyl)pyrrole-3-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 78852531 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | ethyl 4-[[2,5-dimethyl-1-(1-phenylethyl)pyrrole-3-carbonyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)c1cc(C)n(C(C)c2ccccc2)c1C |
| InChI | InChI=1S/C21H28N2O3/c1-5-26-20(24)12-9-13-22-21(25)19-14-15(2)23(17(19)4)16(3)18-10-7-6-8-11-18/h6-8,10-11,14,16H,5,9,12-13H2,1-4H3,(H,22,25) |
| InChIKey | PLYBWFWBJOWFNU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|