C24H36N4O — CID 78873990
N-[3-(4-ethylpiperazin-1-yl)propyl]-2,5-dimethyl-1-(1-phenylethyl)pyrrole-3-carboxamide (PubChem CID 78873990) has the molecular formula C24H36N4O and a molecular weight of 396.58 g/mol. Its IUPAC name is N-[3-(4-ethylpiperazin-1-yl)propyl]-2,5-dimethyl-1-(1-phenylethyl)pyrrole-3-carboxamide.
| Compound Name | N-[3-(4-ethylpiperazin-1-yl)propyl]-2,5-dimethyl-1-(1-phenylethyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 78873990 |
| Molecular Formula | C24H36N4O |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | N-[3-(4-ethylpiperazin-1-yl)propyl]-2,5-dimethyl-1-(1-phenylethyl)pyrrole-3-carboxamide |
| SMILES | CCN1CCN(CCCNC(=O)c2cc(C)n(C(C)c3ccccc3)c2C)CC1 |
| InChI | InChI=1S/C24H36N4O/c1-5-26-14-16-27(17-15-26)13-9-12-25-24(29)23-18-19(2)28(21(23)4)20(3)22-10-7-6-8-11-22/h6-8,10-11,18,20H,5,9,12-17H2,1-4H3,(H,25,29) |
| InChIKey | IPDUEYLRKMHEPM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|