C16H23Cl2N3O — CID 47029242
2,5-dichloro-N-[3-(4-ethylpiperazin-1-yl)propyl]benzamide (PubChem CID 47029242) has the molecular formula C16H23Cl2N3O and a molecular weight of 344.29 g/mol. Its IUPAC name is 2,5-dichloro-N-[3-(4-ethylpiperazin-1-yl)propyl]benzamide.
| Compound Name | 2,5-dichloro-N-[3-(4-ethylpiperazin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 47029242 |
| Molecular Formula | C16H23Cl2N3O |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 2,5-dichloro-N-[3-(4-ethylpiperazin-1-yl)propyl]benzamide |
| SMILES | CCN1CCN(CCCNC(=O)c2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C16H23Cl2N3O/c1-2-20-8-10-21(11-9-20)7-3-6-19-16(22)14-12-13(17)4-5-15(14)18/h4-5,12H,2-3,6-11H2,1H3,(H,19,22) |
| InChIKey | YNSZCMZGGBGSFY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|