C17H25Cl2N3O2 — CID 55660167
2-(2,5-dichlorophenoxy)-N-[3-(4-ethylpiperazin-1-yl)propyl]acetamide (PubChem CID 55660167) has the molecular formula C17H25Cl2N3O2 and a molecular weight of 374.31 g/mol. Its IUPAC name is 2-(2,5-dichlorophenoxy)-N-[3-(4-ethylpiperazin-1-yl)propyl]acetamide.
| Compound Name | 2-(2,5-dichlorophenoxy)-N-[3-(4-ethylpiperazin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 55660167 |
| Molecular Formula | C17H25Cl2N3O2 |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 2-(2,5-dichlorophenoxy)-N-[3-(4-ethylpiperazin-1-yl)propyl]acetamide |
| SMILES | CCN1CCN(CCCNC(=O)COc2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C17H25Cl2N3O2/c1-2-21-8-10-22(11-9-21)7-3-6-20-17(23)13-24-16-12-14(18)4-5-15(16)19/h4-5,12H,2-3,6-11,13H2,1H3,(H,20,23) |
| InChIKey | GCXARUHIDAPXSU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|