C12H17Cl3N2O2 — CID 119504659
2-(2,5-dichlorophenoxy)-N-[2-(ethylamino)ethyl]acetamide;hydrochloride (PubChem CID 119504659) has the molecular formula C12H17Cl3N2O2 and a molecular weight of 327.64 g/mol. Its IUPAC name is 2-(2,5-dichlorophenoxy)-N-[2-(ethylamino)ethyl]acetamide;hydrochloride.
| Compound Name | 2-(2,5-dichlorophenoxy)-N-[2-(ethylamino)ethyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119504659 |
| Molecular Formula | C12H17Cl3N2O2 |
| Molecular Weight | 327.64 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 2-(2,5-dichlorophenoxy)-N-[2-(ethylamino)ethyl]acetamide;hydrochloride |
| SMILES | CCNCCNC(=O)COc1cc(Cl)ccc1Cl.Cl |
| InChI | InChI=1S/C12H16Cl2N2O2.ClH/c1-2-15-5-6-16-12(17)8-18-11-7-9(13)3-4-10(11)14;/h3-4,7,15H,2,5-6,8H2,1H3,(H,16,17);1H |
| InChIKey | YVDITYIIGKTGKF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.64 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|