C12H16Cl2N2O2 — CID 19165328
2-(2,5-dichlorophenoxy)-N-[2-(dimethylamino)ethyl]acetamide (PubChem CID 19165328) has the molecular formula C12H16Cl2N2O2 and a molecular weight of 291.18 g/mol. Its IUPAC name is 2-(2,5-dichlorophenoxy)-N-[2-(dimethylamino)ethyl]acetamide.
| Compound Name | 2-(2,5-dichlorophenoxy)-N-[2-(dimethylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 19165328 |
| Molecular Formula | C12H16Cl2N2O2 |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 2-(2,5-dichlorophenoxy)-N-[2-(dimethylamino)ethyl]acetamide |
| SMILES | CN(C)CCNC(=O)COc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H16Cl2N2O2/c1-16(2)6-5-15-12(17)8-18-11-7-9(13)3-4-10(11)14/h3-4,7H,5-6,8H2,1-2H3,(H,15,17) |
| InChIKey | UKBUWLJPJOKLTQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |