C13H19ClN2O3 — CID 119944593
ethyl 4-[(2-aminobenzoyl)amino]butanoate;hydrochloride (PubChem CID 119944593) has the molecular formula C13H19ClN2O3 and a molecular weight of 286.76 g/mol. Its IUPAC name is ethyl 4-[(2-aminobenzoyl)amino]butanoate;hydrochloride.
| Compound Name | ethyl 4-[(2-aminobenzoyl)amino]butanoate;hydrochloride |
|---|---|
| PubChem CID | 119944593 |
| Molecular Formula | C13H19ClN2O3 |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | ethyl 4-[(2-aminobenzoyl)amino]butanoate;hydrochloride |
| SMILES | CCOC(=O)CCCNC(=O)c1ccccc1N.Cl |
| InChI | InChI=1S/C13H18N2O3.ClH/c1-2-18-12(16)8-5-9-15-13(17)10-6-3-4-7-11(10)14;/h3-4,6-7H,2,5,8-9,14H2,1H3,(H,15,17);1H |
| InChIKey | FQEBZTGNWSFFFN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|