C14H17F2NO3S — CID 60718055
ethyl 4-[[2-(difluoromethylsulfanyl)benzoyl]amino]butanoate (PubChem CID 60718055) has the molecular formula C14H17F2NO3S and a molecular weight of 317.36 g/mol. Its IUPAC name is ethyl 4-[[2-(difluoromethylsulfanyl)benzoyl]amino]butanoate.
| Compound Name | ethyl 4-[[2-(difluoromethylsulfanyl)benzoyl]amino]butanoate |
|---|---|
| PubChem CID | 60718055 |
| Molecular Formula | C14H17F2NO3S |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | ethyl 4-[[2-(difluoromethylsulfanyl)benzoyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)c1ccccc1SC(F)F |
| InChI | InChI=1S/C14H17F2NO3S/c1-2-20-12(18)8-5-9-17-13(19)10-6-3-4-7-11(10)21-14(15)16/h3-4,6-7,14H,2,5,8-9H2,1H3,(H,17,19) |
| InChIKey | WHMXVTIFUVDWOG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|