C13H17F2NO2S2 — CID 103800613
2-(difluoromethylsulfanyl)-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzamide (PubChem CID 103800613) has the molecular formula C13H17F2NO2S2 and a molecular weight of 321.41 g/mol. Its IUPAC name is 2-(difluoromethylsulfanyl)-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzamide.
| Compound Name | 2-(difluoromethylsulfanyl)-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzamide |
|---|---|
| PubChem CID | 103800613 |
| Molecular Formula | C13H17F2NO2S2 |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 2-(difluoromethylsulfanyl)-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzamide |
| SMILES | O=C(NCCSCCCO)c1ccccc1SC(F)F |
| InChI | InChI=1S/C13H17F2NO2S2/c14-13(15)20-11-5-2-1-4-10(11)12(18)16-6-9-19-8-3-7-17/h1-2,4-5,13,17H,3,6-9H2,(H,16,18) |
| InChIKey | LTYOQYUFBDNRBP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|