C16H20F2N2O3S — CID 24644251
ethyl 4-[[2-(difluoromethylsulfanyl)benzoyl]amino]piperidine-1-carboxylate (PubChem CID 24644251) has the molecular formula C16H20F2N2O3S and a molecular weight of 358.41 g/mol. Its IUPAC name is ethyl 4-[[2-(difluoromethylsulfanyl)benzoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-(difluoromethylsulfanyl)benzoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 24644251 |
| Molecular Formula | C16H20F2N2O3S |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | ethyl 4-[[2-(difluoromethylsulfanyl)benzoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)c2ccccc2SC(F)F)CC1 |
| InChI | InChI=1S/C16H20F2N2O3S/c1-2-23-16(22)20-9-7-11(8-10-20)19-14(21)12-5-3-4-6-13(12)24-15(17)18/h3-6,11,15H,2,7-10H2,1H3,(H,19,21) |
| InChIKey | QCYBKTBLAMFXFN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |