C17H24N2O3S — CID 108561614
2-methylpropyl 4-[(2-sulfanylbenzoyl)amino]piperidine-1-carboxylate (PubChem CID 108561614) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is 2-methylpropyl 4-[(2-sulfanylbenzoyl)amino]piperidine-1-carboxylate.
| Compound Name | 2-methylpropyl 4-[(2-sulfanylbenzoyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108561614 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 2-methylpropyl 4-[(2-sulfanylbenzoyl)amino]piperidine-1-carboxylate |
| SMILES | CC(C)COC(=O)N1CCC(NC(=O)c2ccccc2S)CC1 |
| InChI | InChI=1S/C17H24N2O3S/c1-12(2)11-22-17(21)19-9-7-13(8-10-19)18-16(20)14-5-3-4-6-15(14)23/h3-6,12-13,23H,7-11H2,1-2H3,(H,18,20) |
| InChIKey | KGMSZOLKOAVCHR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|