C22H23BrN2O4 — CID 36884910
ethyl 4-[[2-(4-bromobenzoyl)benzoyl]amino]piperidine-1-carboxylate (PubChem CID 36884910) has the molecular formula C22H23BrN2O4 and a molecular weight of 459.34 g/mol. Its IUPAC name is ethyl 4-[[2-(4-bromobenzoyl)benzoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-(4-bromobenzoyl)benzoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 36884910 |
| Molecular Formula | C22H23BrN2O4 |
| Molecular Weight | 459.34 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | ethyl 4-[[2-(4-bromobenzoyl)benzoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)c2ccccc2C(=O)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C22H23BrN2O4/c1-2-29-22(28)25-13-11-17(12-14-25)24-21(27)19-6-4-3-5-18(19)20(26)15-7-9-16(23)10-8-15/h3-10,17H,2,11-14H2,1H3,(H,24,27) |
| InChIKey | YNLRIBJJHWGSTC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |