C15H20FN3O3 — CID 110451817
ethyl 4-[(2-amino-3-fluorobenzoyl)amino]piperidine-1-carboxylate (PubChem CID 110451817) has the molecular formula C15H20FN3O3 and a molecular weight of 309.34 g/mol. Its IUPAC name is ethyl 4-[(2-amino-3-fluorobenzoyl)amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(2-amino-3-fluorobenzoyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 110451817 |
| Molecular Formula | C15H20FN3O3 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | ethyl 4-[(2-amino-3-fluorobenzoyl)amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)c2cccc(F)c2N)CC1 |
| InChI | InChI=1S/C15H20FN3O3/c1-2-22-15(21)19-8-6-10(7-9-19)18-14(20)11-4-3-5-12(16)13(11)17/h3-5,10H,2,6-9,17H2,1H3,(H,18,20) |
| InChIKey | SDJOWUASVHZPJR-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|