C15H19ClFN3O3 — CID 108896619
ethyl 4-[(2-chloro-6-fluorophenyl)carbamoylamino]piperidine-1-carboxylate (PubChem CID 108896619) has the molecular formula C15H19ClFN3O3 and a molecular weight of 343.79 g/mol. Its IUPAC name is ethyl 4-[(2-chloro-6-fluorophenyl)carbamoylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(2-chloro-6-fluorophenyl)carbamoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108896619 |
| Molecular Formula | C15H19ClFN3O3 |
| Molecular Weight | 343.79 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | ethyl 4-[(2-chloro-6-fluorophenyl)carbamoylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)Nc2c(F)cccc2Cl)CC1 |
| InChI | InChI=1S/C15H19ClFN3O3/c1-2-23-15(22)20-8-6-10(7-9-20)18-14(21)19-13-11(16)4-3-5-12(13)17/h3-5,10H,2,6-9H2,1H3,(H2,18,19,21) |
| InChIKey | MJJQJZSGVZNUKS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.79 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |