C10H10ClFN2O — CID 108896615
1-(2-chloro-6-fluorophenyl)-3-cyclopropylurea (PubChem CID 108896615) has the molecular formula C10H10ClFN2O and a molecular weight of 228.65 g/mol. Its IUPAC name is 1-(2-chloro-6-fluorophenyl)-3-cyclopropylurea.
| Compound Name | 1-(2-chloro-6-fluorophenyl)-3-cyclopropylurea |
|---|---|
| PubChem CID | 108896615 |
| Molecular Formula | C10H10ClFN2O |
| Molecular Weight | 228.65 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 1-(2-chloro-6-fluorophenyl)-3-cyclopropylurea |
| SMILES | O=C(Nc1c(F)cccc1Cl)NC1CC1 |
| InChI | InChI=1S/C10H10ClFN2O/c11-7-2-1-3-8(12)9(7)14-10(15)13-6-4-5-6/h1-3,6H,4-5H2,(H2,13,14,15) |
| InChIKey | RZOWBKNZMCGPNP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.65 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |