C10H9Cl3N2O — CID 116654082
1-cyclopropyl-3-(2,4,6-trichlorophenyl)urea (PubChem CID 116654082) has the molecular formula C10H9Cl3N2O and a molecular weight of 279.55 g/mol. Its IUPAC name is 1-cyclopropyl-3-(2,4,6-trichlorophenyl)urea.
| Compound Name | 1-cyclopropyl-3-(2,4,6-trichlorophenyl)urea |
|---|---|
| PubChem CID | 116654082 |
| Molecular Formula | C10H9Cl3N2O |
| Molecular Weight | 279.55 g/mol |
| Exact Mass | 277.98 |
| IUPAC Name | 1-cyclopropyl-3-(2,4,6-trichlorophenyl)urea |
| SMILES | O=C(Nc1c(Cl)cc(Cl)cc1Cl)NC1CC1 |
| InChI | InChI=1S/C10H9Cl3N2O/c11-5-3-7(12)9(8(13)4-5)15-10(16)14-6-1-2-6/h3-4,6H,1-2H2,(H2,14,15,16) |
| InChIKey | KPNPENDIFKNAJX-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.55 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |