C11H11Cl3N2O — CID 60647047
2-(cyclopropylamino)-N-(2,4,6-trichlorophenyl)acetamide (PubChem CID 60647047) has the molecular formula C11H11Cl3N2O and a molecular weight of 293.58 g/mol. Its IUPAC name is 2-(cyclopropylamino)-N-(2,4,6-trichlorophenyl)acetamide.
| Compound Name | 2-(cyclopropylamino)-N-(2,4,6-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 60647047 |
| Molecular Formula | C11H11Cl3N2O |
| Molecular Weight | 293.58 g/mol |
| Exact Mass | 291.99 |
| IUPAC Name | 2-(cyclopropylamino)-N-(2,4,6-trichlorophenyl)acetamide |
| SMILES | O=C(CNC1CC1)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C11H11Cl3N2O/c12-6-3-8(13)11(9(14)4-6)16-10(17)5-15-7-1-2-7/h3-4,7,15H,1-2,5H2,(H,16,17) |
| InChIKey | IRMNEKZLXIUMCW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.58 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |