C13H16Cl2N2O2 — CID 43627352
N-(2,6-dichlorophenyl)-2-(oxan-4-ylamino)acetamide (PubChem CID 43627352) has the molecular formula C13H16Cl2N2O2 and a molecular weight of 303.19 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-2-(oxan-4-ylamino)acetamide.
| Compound Name | N-(2,6-dichlorophenyl)-2-(oxan-4-ylamino)acetamide |
|---|---|
| PubChem CID | 43627352 |
| Molecular Formula | C13H16Cl2N2O2 |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | N-(2,6-dichlorophenyl)-2-(oxan-4-ylamino)acetamide |
| SMILES | O=C(CNC1CCOCC1)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H16Cl2N2O2/c14-10-2-1-3-11(15)13(10)17-12(18)8-16-9-4-6-19-7-5-9/h1-3,9,16H,4-8H2,(H,17,18) |
| InChIKey | BYIYERGGPGKIIY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |