C12H13Cl3N2O — CID 67521970
1-cyclopentyl-3-(2,4,6-trichlorophenyl)urea (PubChem CID 67521970) has the molecular formula C12H13Cl3N2O and a molecular weight of 307.61 g/mol. Its IUPAC name is 1-cyclopentyl-3-(2,4,6-trichlorophenyl)urea.
| Compound Name | 1-cyclopentyl-3-(2,4,6-trichlorophenyl)urea |
|---|---|
| PubChem CID | 67521970 |
| Molecular Formula | C12H13Cl3N2O |
| Molecular Weight | 307.61 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 1-cyclopentyl-3-(2,4,6-trichlorophenyl)urea |
| SMILES | O=C(Nc1c(Cl)cc(Cl)cc1Cl)NC1CCCC1 |
| InChI | InChI=1S/C12H13Cl3N2O/c13-7-5-9(14)11(10(15)6-7)17-12(18)16-8-3-1-2-4-8/h5-6,8H,1-4H2,(H2,16,17,18) |
| InChIKey | RWWQINQQBWPJMV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.61 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |