C20H28Cl2N4O2 — CID 4253311
1-cyclohexyl-3-[2,5-dichloro-4-(cyclohexylcarbamoylamino)phenyl]urea (PubChem CID 4253311) has the molecular formula C20H28Cl2N4O2 and a molecular weight of 427.38 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2,5-dichloro-4-(cyclohexylcarbamoylamino)phenyl]urea.
| Compound Name | 1-cyclohexyl-3-[2,5-dichloro-4-(cyclohexylcarbamoylamino)phenyl]urea |
|---|---|
| PubChem CID | 4253311 |
| Molecular Formula | C20H28Cl2N4O2 |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 1-cyclohexyl-3-[2,5-dichloro-4-(cyclohexylcarbamoylamino)phenyl]urea |
| SMILES | O=C(Nc1cc(Cl)c(NC(=O)NC2CCCCC2)cc1Cl)NC1CCCCC1 |
| InChI | InChI=1S/C20H28Cl2N4O2/c21-15-12-18(26-20(28)24-14-9-5-2-6-10-14)16(22)11-17(15)25-19(27)23-13-7-3-1-4-8-13/h11-14H,1-10H2,(H2,23,25,27)(H2,24,26,28) |
| InChIKey | SHINYSWLIRNZDW-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |