C15H21ClN4O2 — CID 39184480
2-amino-N-[2-chloro-5-(cyclohexylcarbamoylamino)phenyl]acetamide (PubChem CID 39184480) has the molecular formula C15H21ClN4O2 and a molecular weight of 324.81 g/mol. Its IUPAC name is 2-amino-N-[2-chloro-5-(cyclohexylcarbamoylamino)phenyl]acetamide.
| Compound Name | 2-amino-N-[2-chloro-5-(cyclohexylcarbamoylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 39184480 |
| Molecular Formula | C15H21ClN4O2 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 2-amino-N-[2-chloro-5-(cyclohexylcarbamoylamino)phenyl]acetamide |
| SMILES | NCC(=O)Nc1cc(NC(=O)NC2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C15H21ClN4O2/c16-12-7-6-11(8-13(12)20-14(21)9-17)19-15(22)18-10-4-2-1-3-5-10/h6-8,10H,1-5,9,17H2,(H,20,21)(H2,18,19,22) |
| InChIKey | IYWBPYWPDODXSW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |