C9H4Cl6N2O — CID 2776833
1-(1,2,2-trichloroethenyl)-3-(2,4,6-trichlorophenyl)urea (PubChem CID 2776833) has the molecular formula C9H4Cl6N2O and a molecular weight of 368.86 g/mol. Its IUPAC name is 1-(1,2,2-trichloroethenyl)-3-(2,4,6-trichlorophenyl)urea.
| Compound Name | 1-(1,2,2-trichloroethenyl)-3-(2,4,6-trichlorophenyl)urea |
|---|---|
| PubChem CID | 2776833 |
| Molecular Formula | C9H4Cl6N2O |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 365.85 |
| IUPAC Name | 1-(1,2,2-trichloroethenyl)-3-(2,4,6-trichlorophenyl)urea |
| SMILES | O=C(NC(Cl)=C(Cl)Cl)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C9H4Cl6N2O/c10-3-1-4(11)6(5(12)2-3)16-9(18)17-8(15)7(13)14/h1-2H,(H2,16,17,18) |
| InChIKey | UOBXMCOARHIKJW-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|