C9H3BrCl3NO — CID 130700613
3-bromo-N-(2,4,6-trichlorophenyl)prop-2-ynamide (PubChem CID 130700613) has the molecular formula C9H3BrCl3NO and a molecular weight of 327.39 g/mol. Its IUPAC name is 3-bromo-N-(2,4,6-trichlorophenyl)prop-2-ynamide.
| Compound Name | 3-bromo-N-(2,4,6-trichlorophenyl)prop-2-ynamide |
|---|---|
| PubChem CID | 130700613 |
| Molecular Formula | C9H3BrCl3NO |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 324.85 |
| IUPAC Name | 3-bromo-N-(2,4,6-trichlorophenyl)prop-2-ynamide |
| SMILES | O=C(C#CBr)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C9H3BrCl3NO/c10-2-1-8(15)14-9-6(12)3-5(11)4-7(9)13/h3-4H,(H,14,15) |
| InChIKey | BNQFBLRUNBPTEN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|