C12H5Cl5N2O — CID 43343719
2,6-dichloro-N-(2,4,6-trichlorophenyl)pyridine-4-carboxamide (PubChem CID 43343719) has the molecular formula C12H5Cl5N2O and a molecular weight of 370.45 g/mol. Its IUPAC name is 2,6-dichloro-N-(2,4,6-trichlorophenyl)pyridine-4-carboxamide.
| Compound Name | 2,6-dichloro-N-(2,4,6-trichlorophenyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 43343719 |
| Molecular Formula | C12H5Cl5N2O |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 367.88 |
| IUPAC Name | 2,6-dichloro-N-(2,4,6-trichlorophenyl)pyridine-4-carboxamide |
| SMILES | O=C(Nc1c(Cl)cc(Cl)cc1Cl)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C12H5Cl5N2O/c13-6-3-7(14)11(8(15)4-6)19-12(20)5-1-9(16)18-10(17)2-5/h1-4H,(H,19,20) |
| InChIKey | CEOYJWJTRLWZJU-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|