C16H14Cl3NO — CID 167943386
2,4,6-trimethyl-N-(2,4,6-trichlorophenyl)benzamide (PubChem CID 167943386) has the molecular formula C16H14Cl3NO and a molecular weight of 342.65 g/mol. Its IUPAC name is 2,4,6-trimethyl-N-(2,4,6-trichlorophenyl)benzamide.
| Compound Name | 2,4,6-trimethyl-N-(2,4,6-trichlorophenyl)benzamide |
|---|---|
| PubChem CID | 167943386 |
| Molecular Formula | C16H14Cl3NO |
| Molecular Weight | 342.65 g/mol |
| Exact Mass | 341.01 |
| IUPAC Name | 2,4,6-trimethyl-N-(2,4,6-trichlorophenyl)benzamide |
| SMILES | Cc1cc(C)c(C(=O)Nc2c(Cl)cc(Cl)cc2Cl)c(C)c1 |
| InChI | InChI=1S/C16H14Cl3NO/c1-8-4-9(2)14(10(3)5-8)16(21)20-15-12(18)6-11(17)7-13(15)19/h4-7H,1-3H3,(H,20,21) |
| InChIKey | PXZADNLXWRXXHH-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.65 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |