C11H11Cl4NO — CID 63679954
3-chloro-2,2-dimethyl-N-(2,4,6-trichlorophenyl)propanamide (PubChem CID 63679954) has the molecular formula C11H11Cl4NO and a molecular weight of 315.03 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-N-(2,4,6-trichlorophenyl)propanamide.
| Compound Name | 3-chloro-2,2-dimethyl-N-(2,4,6-trichlorophenyl)propanamide |
|---|---|
| PubChem CID | 63679954 |
| Molecular Formula | C11H11Cl4NO |
| Molecular Weight | 315.03 g/mol |
| Exact Mass | 312.96 |
| IUPAC Name | 3-chloro-2,2-dimethyl-N-(2,4,6-trichlorophenyl)propanamide |
| SMILES | CC(C)(CCl)C(=O)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C11H11Cl4NO/c1-11(2,5-12)10(17)16-9-7(14)3-6(13)4-8(9)15/h3-4H,5H2,1-2H3,(H,16,17) |
| InChIKey | FCLPUKJBFUPXEG-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.03 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|