C10H3Cl4F6NO — CID 71672617
2-chloro-3,3,3-trifluoro-N-(2,4,6-trichlorophenyl)-2-(trifluoromethyl)propanamide (PubChem CID 71672617) has the molecular formula C10H3Cl4F6NO and a molecular weight of 408.94 g/mol. Its IUPAC name is 2-chloro-3,3,3-trifluoro-N-(2,4,6-trichlorophenyl)-2-(trifluoromethyl)propanamide.
| Compound Name | 2-chloro-3,3,3-trifluoro-N-(2,4,6-trichlorophenyl)-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 71672617 |
| Molecular Formula | C10H3Cl4F6NO |
| Molecular Weight | 408.94 g/mol |
| Exact Mass | 406.89 |
| IUPAC Name | 2-chloro-3,3,3-trifluoro-N-(2,4,6-trichlorophenyl)-2-(trifluoromethyl)propanamide |
| SMILES | O=C(Nc1c(Cl)cc(Cl)cc1Cl)C(Cl)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H3Cl4F6NO/c11-3-1-4(12)6(5(13)2-3)21-7(22)8(14,9(15,16)17)10(18,19)20/h1-2H,(H,21,22) |
| InChIKey | XQYCFORFLBSFTA-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.94 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|